C40H40ClF5N2O6S — CID 156851299
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(2R)-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-methylpentanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 156851299) has the molecular formula C40H40ClF5N2O6S and a molecular weight of 807.28 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(2R)-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-methylpentanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(2R)-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-methylpentanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 156851299 |
| Molecular Formula | C40H40ClF5N2O6S |
| Molecular Weight | 807.28 g/mol |
| Exact Mass | 806.22 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[(2R)-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-methylpentanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CC(C)C[C@H](C(=O)N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)c1ccc(C(=O)O)c(O)c1)N(Cc1ccc(Cl)cc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C40H40ClF5N2O6S/c1-21(2)14-30(48(20-22-6-10-27(41)11-7-22)55(53,54)37-35(45)33(43)32(42)34(44)36(37)46)38(50)47(28-12-13-29(39(51)52)31(49)18-28)19-23-15-25(24-8-9-24)17-26(16-23)40(3,4)5/h6-7,10-13,15-18,21,24,30,49H,8-9,14,19-20H2,1-5H3,(H,51,52)/t30-/m1/s1 |
| InChIKey | MNUWQLCAAKFPMB-SSEXGKCCSA-N |
| XLogP | 9.45 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.28 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|