C31H31F5N2O5S — CID 135257605
4-[(4-cyclohexylphenyl)methyl-[4-hydroxy-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257605) has the molecular formula C31H31F5N2O5S and a molecular weight of 638.66 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[4-hydroxy-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[4-hydroxy-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257605 |
| Molecular Formula | C31H31F5N2O5S |
| Molecular Weight | 638.66 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[4-hydroxy-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]butanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CN(Sc1c(F)c(F)c(F)c(F)c1F)C(CCO)C(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C31H31F5N2O5S/c1-37(44-29-27(35)25(33)24(32)26(34)28(29)36)22(13-14-39)30(41)38(20-11-12-21(31(42)43)23(40)15-20)16-17-7-9-19(10-8-17)18-5-3-2-4-6-18/h7-12,15,18,22,39-40H,2-6,13-14,16H2,1H3,(H,42,43) |
| InChIKey | ZZGALRNSPSICGV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|