C30H27F5N2O4S — CID 135257763
4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-3-carbonyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257763) has the molecular formula C30H27F5N2O4S and a molecular weight of 606.61 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-3-carbonyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-3-carbonyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257763 |
| Molecular Formula | C30H27F5N2O4S |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-3-carbonyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)C2CN(Sc3c(F)c(F)c(F)c(F)c3F)C2)cc1O |
| InChI | InChI=1S/C30H27F5N2O4S/c31-23-24(32)26(34)28(27(35)25(23)33)42-36-14-19(15-36)29(39)37(20-10-11-21(30(40)41)22(38)12-20)13-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h6-12,17,19,38H,1-5,13-15H2,(H,40,41) |
| InChIKey | AKPPJHLNCUWDBP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|