C31H30F5N3O6S — CID 135257699
(2R)-N-[(4-cyclohexylphenyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 135257699) has the molecular formula C31H30F5N3O6S and a molecular weight of 667.65 g/mol. Its IUPAC name is (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135257699 |
| Molecular Formula | C31H30F5N3O6S |
| Molecular Weight | 667.65 g/mol |
| Exact Mass | 667.18 |
| IUPAC Name | (2R)-N-[(4-cyclohexylphenyl)methyl]-N-[3-hydroxy-4-(hydroxycarbamoyl)phenyl]-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NO)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)[C@H]2CCCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C31H30F5N3O6S/c32-24-25(33)27(35)29(28(36)26(24)34)46(44,45)39-14-4-7-22(39)31(42)38(20-12-13-21(23(40)15-20)30(41)37-43)16-17-8-10-19(11-9-17)18-5-2-1-3-6-18/h8-13,15,18,22,40,43H,1-7,14,16H2,(H,37,41)/t22-/m1/s1 |
| InChIKey | MHKULWPFXFEECH-JOCHJYFZSA-N |
| XLogP | 5.64 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|