C29H26F5N3O6S — CID 135257551
4-[(6-cyclohexyl-3-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257551) has the molecular formula C29H26F5N3O6S and a molecular weight of 639.60 g/mol. Its IUPAC name is 4-[(6-cyclohexyl-3-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(6-cyclohexyl-3-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257551 |
| Molecular Formula | C29H26F5N3O6S |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | 4-[(6-cyclohexyl-3-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)nc2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C29H26F5N3O6S/c30-22-23(31)25(33)27(26(34)24(22)32)44(42,43)37-11-10-20(37)28(39)36(17-7-8-18(29(40)41)21(38)12-17)14-15-6-9-19(35-13-15)16-4-2-1-3-5-16/h6-9,12-13,16,20,38H,1-5,10-11,14H2,(H,40,41)/t20-/m1/s1 |
| InChIKey | PIDDNRVMSQJLOT-HXUWFJFHSA-N |
| XLogP | 5.22 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|