C31H31F5N2O6S — CID 135257845
4-[(4-cyclohexylphenyl)methyl-[2-methyl-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257845) has the molecular formula C31H31F5N2O6S and a molecular weight of 654.65 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-methyl-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-methyl-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257845 |
| Molecular Formula | C31H31F5N2O6S |
| Molecular Weight | 654.65 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-methyl-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CN(C(C)(C)C(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)c(O)c1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C31H31F5N2O6S/c1-31(2,37(3)45(43,44)28-26(35)24(33)23(32)25(34)27(28)36)30(42)38(20-13-14-21(29(40)41)22(39)15-20)16-17-9-11-19(12-10-17)18-7-5-4-6-8-18/h9-15,18,39H,4-8,16H2,1-3H3,(H,40,41) |
| InChIKey | XOBCTASUPIPAQG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|