C37H33F5N2O8S — CID 73334464
4-[(4-cyclohexylphenyl)methyl-[2-[(2-methoxycarbonylphenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 73334464) has the molecular formula C37H33F5N2O8S and a molecular weight of 760.73 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-[(2-methoxycarbonylphenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2-methoxycarbonylphenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 73334464 |
| Molecular Formula | C37H33F5N2O8S |
| Molecular Weight | 760.73 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2-methoxycarbonylphenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | COC(=O)c1ccccc1CN(CC(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)c(O)c1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H33F5N2O8S/c1-52-37(49)26-10-6-5-9-24(26)19-43(53(50,51)35-33(41)31(39)30(38)32(40)34(35)42)20-29(46)44(25-15-16-27(36(47)48)28(45)17-25)18-21-11-13-23(14-12-21)22-7-3-2-4-8-22/h5-6,9-17,22,45H,2-4,7-8,18-20H2,1H3,(H,47,48) |
| InChIKey | WEGVIYMOYLQIFP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|