C28H25F5N2O4S — CID 135257645
4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257645) has the molecular formula C28H25F5N2O4S and a molecular weight of 580.58 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257645 |
| Molecular Formula | C28H25F5N2O4S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)CNSc2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C28H25F5N2O4S/c29-22-23(30)25(32)27(26(33)24(22)31)40-34-13-21(37)35(18-10-11-19(28(38)39)20(36)12-18)14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h6-12,16,34,36H,1-5,13-14H2,(H,38,39) |
| InChIKey | LOICIVZBKCYFEZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|