C37H37N3O6S — CID 123284111
4-[(4-cyclohexylphenyl)methyl-[2-[(4-isocyanophenyl)methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 123284111) has the molecular formula C37H37N3O6S and a molecular weight of 651.79 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-[(4-isocyanophenyl)methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(4-isocyanophenyl)methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 123284111 |
| Molecular Formula | C37H37N3O6S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(4-isocyanophenyl)methyl-(4-methylphenyl)sulfonylamino]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | [C-]#[N+]c1ccc(CN(CC(=O)N(Cc2ccc(C3CCCCC3)cc2)c2ccc(C(=O)O)c(O)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H37N3O6S/c1-26-8-19-33(20-9-26)47(45,46)39(23-27-12-16-31(38-2)17-13-27)25-36(42)40(32-18-21-34(37(43)44)35(41)22-32)24-28-10-14-30(15-11-28)29-6-4-3-5-7-29/h8-22,29,41H,3-7,23-25H2,1H3,(H,43,44) |
| InChIKey | MTESNPDUTZVOJA-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|