C30H28F6N2O5S — CID 135257742
4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-fluorobenzoic acid (PubChem CID 135257742) has the molecular formula C30H28F6N2O5S and a molecular weight of 642.62 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-fluorobenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 135257742 |
| Molecular Formula | C30H28F6N2O5S |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-2-fluorobenzoic acid |
| SMILES | C[C@H](C(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)c(F)c1)N(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H28F6N2O5S/c1-16(37(2)44(42,43)28-26(35)24(33)23(32)25(34)27(28)36)29(39)38(20-12-13-21(30(40)41)22(31)14-20)15-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h8-14,16,18H,3-7,15H2,1-2H3,(H,40,41)/t16-/m1/s1 |
| InChIKey | MQPIRZBHRRAPSK-MRXNPFEDSA-N |
| XLogP | 6.51 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|