C30H29F6N3O5S — CID 135257541
4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-3-fluoro-N-hydroxybenzamide (PubChem CID 135257541) has the molecular formula C30H29F6N3O5S and a molecular weight of 657.63 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-3-fluoro-N-hydroxybenzamide.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-3-fluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135257541 |
| Molecular Formula | C30H29F6N3O5S |
| Molecular Weight | 657.63 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[(2R)-2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoyl]amino]-3-fluoro-N-hydroxybenzamide |
| SMILES | C[C@H](C(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)NO)cc1F)N(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H29F6N3O5S/c1-16(38(2)45(43,44)28-26(35)24(33)23(32)25(34)27(28)36)30(41)39(22-13-12-20(14-21(22)31)29(40)37-42)15-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h8-14,16,18,42H,3-7,15H2,1-2H3,(H,37,40)/t16-/m1/s1 |
| InChIKey | KBMLZVOAQHNHLG-MRXNPFEDSA-N |
| XLogP | 5.93 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|