C29H26ClF5N2O3S — CID 135257698
3-chloro-4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]benzoic acid (PubChem CID 135257698) has the molecular formula C29H26ClF5N2O3S and a molecular weight of 613.05 g/mol. Its IUPAC name is 3-chloro-4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]benzoic acid.
| Compound Name | 3-chloro-4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135257698 |
| Molecular Formula | C29H26ClF5N2O3S |
| Molecular Weight | 613.05 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 3-chloro-4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]amino]benzoic acid |
| SMILES | CN(CC(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)cc1Cl)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H26ClF5N2O3S/c1-36(41-28-26(34)24(32)23(31)25(33)27(28)35)15-22(38)37(21-12-11-19(29(39)40)13-20(21)30)14-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h7-13,17H,2-6,14-15H2,1H3,(H,39,40) |
| InChIKey | WLEJWXWQOLLZSI-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.05 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|