C30H28F6N2O5S — CID 135257849
3-fluoro-4-[[4-(oxan-4-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid (PubChem CID 135257849) has the molecular formula C30H28F6N2O5S and a molecular weight of 642.62 g/mol. Its IUPAC name is 3-fluoro-4-[[4-(oxan-4-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid.
| Compound Name | 3-fluoro-4-[[4-(oxan-4-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135257849 |
| Molecular Formula | C30H28F6N2O5S |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 3-fluoro-4-[[4-(oxan-4-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid |
| SMILES | CCCN(CC(=O)N(Cc1ccc(C2CCOCC2)cc1)c1ccc(C(=O)O)cc1F)S(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H28F6N2O5S/c1-2-11-37(44(42)29-27(35)25(33)24(32)26(34)28(29)36)16-23(39)38(22-8-7-20(30(40)41)14-21(22)31)15-17-3-5-18(6-4-17)19-9-12-43-13-10-19/h3-8,14,19H,2,9-13,15-16H2,1H3,(H,40,41) |
| InChIKey | NIQGMPFOCVAKIX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|