C29H24F6N2O5S — CID 135257633
5-fluoro-2-hydroxy-4-[[4-(oxan-4-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]benzoic acid (PubChem CID 135257633) has the molecular formula C29H24F6N2O5S and a molecular weight of 626.58 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-4-[[4-(oxan-4-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 5-fluoro-2-hydroxy-4-[[4-(oxan-4-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135257633 |
| Molecular Formula | C29H24F6N2O5S |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 5-fluoro-2-hydroxy-4-[[4-(oxan-4-yl)phenyl]methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfanylazetidine-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(N(Cc2ccc(C3CCOCC3)cc2)C(=O)[C@H]2CCN2Sc2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C29H24F6N2O5S/c30-18-11-17(29(40)41)21(38)12-20(18)36(13-14-1-3-15(4-2-14)16-6-9-42-10-7-16)28(39)19-5-8-37(19)43-27-25(34)23(32)22(31)24(33)26(27)35/h1-4,11-12,16,19,38H,5-10,13H2,(H,40,41)/t19-/m1/s1 |
| InChIKey | SOGCYAPIUBKJOT-LJQANCHMSA-N |
| XLogP | 6.13 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|