C29H27F5N2O6S — CID 135257625
2-hydroxy-4-[[4-(oxolan-3-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid (PubChem CID 135257625) has the molecular formula C29H27F5N2O6S and a molecular weight of 626.60 g/mol. Its IUPAC name is 2-hydroxy-4-[[4-(oxolan-3-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[4-(oxolan-3-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135257625 |
| Molecular Formula | C29H27F5N2O6S |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 2-hydroxy-4-[[4-(oxolan-3-yl)phenyl]methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfinyl-propylamino]acetyl]amino]benzoic acid |
| SMILES | CCCN(CC(=O)N(Cc1ccc(C2CCOC2)cc1)c1ccc(C(=O)O)c(O)c1)S(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H27F5N2O6S/c1-2-10-35(43(41)28-26(33)24(31)23(30)25(32)27(28)34)14-22(38)36(19-7-8-20(29(39)40)21(37)12-19)13-16-3-5-17(6-4-16)18-9-11-42-15-18/h3-8,12,18,37H,2,9-11,13-15H2,1H3,(H,39,40) |
| InChIKey | MQFHJIADBAZXRY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|