C32H31F5N2O4 — CID 142404725
N-[2-[N-[(4-cyclohexylphenyl)methyl]-4-formyl-3-hydroxyanilino]-2-oxoethyl]-2,3,4,5,6-pentafluoro-N-propylbenzamide (PubChem CID 142404725) has the molecular formula C32H31F5N2O4 and a molecular weight of 602.60 g/mol. Its IUPAC name is N-[2-[N-[(4-cyclohexylphenyl)methyl]-4-formyl-3-hydroxyanilino]-2-oxoethyl]-2,3,4,5,6-pentafluoro-N-propylbenzamide.
| Compound Name | N-[2-[N-[(4-cyclohexylphenyl)methyl]-4-formyl-3-hydroxyanilino]-2-oxoethyl]-2,3,4,5,6-pentafluoro-N-propylbenzamide |
|---|---|
| PubChem CID | 142404725 |
| Molecular Formula | C32H31F5N2O4 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | N-[2-[N-[(4-cyclohexylphenyl)methyl]-4-formyl-3-hydroxyanilino]-2-oxoethyl]-2,3,4,5,6-pentafluoro-N-propylbenzamide |
| SMILES | CCCN(CC(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C=O)c(O)c1)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H31F5N2O4/c1-2-14-38(32(43)26-27(33)29(35)31(37)30(36)28(26)34)17-25(42)39(23-13-12-22(18-40)24(41)15-23)16-19-8-10-21(11-9-19)20-6-4-3-5-7-20/h8-13,15,18,20,41H,2-7,14,16-17H2,1H3 |
| InChIKey | KSNOQMSOTMWNBZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|