C33H44F3N2O5P — CID 88580371
butyl 2-butoxy-4-[(4-cyclohexylphenyl)methyl-[2-[phosphanylmethyl-(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzoate (PubChem CID 88580371) has the molecular formula C33H44F3N2O5P and a molecular weight of 636.69 g/mol. Its IUPAC name is butyl 2-butoxy-4-[(4-cyclohexylphenyl)methyl-[2-[phosphanylmethyl-(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzoate.
| Compound Name | butyl 2-butoxy-4-[(4-cyclohexylphenyl)methyl-[2-[phosphanylmethyl-(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 88580371 |
| Molecular Formula | C33H44F3N2O5P |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | butyl 2-butoxy-4-[(4-cyclohexylphenyl)methyl-[2-[phosphanylmethyl-(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)CN(CP)C(=O)C(F)(F)F)cc1OCCCC |
| InChI | InChI=1S/C33H44F3N2O5P/c1-3-5-18-42-29-20-27(16-17-28(29)31(40)43-19-6-4-2)38(30(39)22-37(23-44)32(41)33(34,35)36)21-24-12-14-26(15-13-24)25-10-8-7-9-11-25/h12-17,20,25H,3-11,18-19,21-23,44H2,1-2H3 |
| InChIKey | KAIJRSZCYDACNS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|