C31H33F5N2O6S — CID 118554196
butyl 4-[benzyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate (PubChem CID 118554196) has the molecular formula C31H33F5N2O6S and a molecular weight of 656.67 g/mol. Its IUPAC name is butyl 4-[benzyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate.
| Compound Name | butyl 4-[benzyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate |
|---|---|
| PubChem CID | 118554196 |
| Molecular Formula | C31H33F5N2O6S |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | butyl 4-[benzyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-2-butoxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(N(Cc2ccccc2)C(=O)CN(C)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1OCCCC |
| InChI | InChI=1S/C31H33F5N2O6S/c1-4-6-15-43-23-17-21(13-14-22(23)31(40)44-16-7-5-2)38(18-20-11-9-8-10-12-20)24(39)19-37(3)45(41,42)30-28(35)26(33)25(32)27(34)29(30)36/h8-14,17H,4-7,15-16,18-19H2,1-3H3 |
| InChIKey | QYDCBVWBWDIBCG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|