C37H24F10N2O6S — CID 118543165
3-benzyl-4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoic acid (PubChem CID 118543165) has the molecular formula C37H24F10N2O6S and a molecular weight of 814.65 g/mol. Its IUPAC name is 3-benzyl-4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoic acid.
| Compound Name | 3-benzyl-4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 118543165 |
| Molecular Formula | C37H24F10N2O6S |
| Molecular Weight | 814.65 g/mol |
| Exact Mass | 814.12 |
| IUPAC Name | 3-benzyl-4-[[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoic acid |
| SMILES | CN(CC(=O)N(Cc1c(F)c(F)c(F)c(F)c1F)c1ccc(C(=O)O)c(OCc2ccccc2)c1Cc1ccccc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H24F10N2O6S/c1-48(56(53,54)36-33(46)31(44)30(43)32(45)34(36)47)16-24(50)49(15-22-25(38)27(40)29(42)28(41)26(22)39)23-13-12-20(37(51)52)35(55-17-19-10-6-3-7-11-19)21(23)14-18-8-4-2-5-9-18/h2-13H,14-17H2,1H3,(H,51,52) |
| InChIKey | DEAGZPGGDPTRHR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|