3-hydroxy-2-phenylmethoxybenzoic acid

C14H12O4 — CID 67658329

IUPAC3-hydroxy-2-phenylmethoxybenzoic acid
SMILESO=C(O)c1cccc(O)c1OCc1ccccc1
InChIInChI=1S/C14H12O4/c15-12-8-4-7-11(14(16)17)13(12)18-9-10-5-2-1-3-6-10/h1-8,15H,9H2,(H,16,17)
InChIKeyWYASXLBIFSLVCG-UHFFFAOYSA-N
MW244.25 g/mol
LogP2.67
Rot. Bonds4

About 3-hydroxy-2-phenylmethoxybenzoic acid

3-hydroxy-2-phenylmethoxybenzoic acid (PubChem CID 67658329) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-hydroxy-2-phenylmethoxybenzoic acid.

Molecular Properties

Compound Name3-hydroxy-2-phenylmethoxybenzoic acid
PubChem CID67658329
Molecular FormulaC14H12O4
Molecular Weight244.25 g/mol
Exact Mass244.07
IUPAC Name3-hydroxy-2-phenylmethoxybenzoic acid
SMILESO=C(O)c1cccc(O)c1OCc1ccccc1
InChIInChI=1S/C14H12O4/c15-12-8-4-7-11(14(16)17)13(12)18-9-10-5-2-1-3-6-10/h1-8,15H,9H2,(H,16,17)
InChIKeyWYASXLBIFSLVCG-UHFFFAOYSA-N
XLogP2.67
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 52.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-hydroxy-2-phenylmethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3,5-dihydroxy-2-phenylmethoxybenzoic acid
CID 118873136
2-phenylmethoxybenzene-1,3-diol
CID 15652625
2-phenylmethoxy-3-(trifluoromethyl)benzoic acid
CID 23450801
2-phenylmethoxy-3-prop-1-enylbenzoic acid
CID 71318162
2-phenyl-3-phenylmethoxybenzoic acid
CID 174811177
2-[[3-[(2-carboxyphenoxy)methyl]phenyl]methoxy]benzoic acid
CID 71356398
3,4-difluoro-2-phenylmethoxybenzoic acid
CID 151244602
3-hydroxy-2-methyl-4,5-bis(phenylmethoxy)benzoic acid
CID 175815077
CID 6334341
CID 6334341
3-hydroxy-2-phenoxybenzoic acid
CID 53406644
3-(4-nitrophenyl)-2-phenylmethoxybenzoic acid
CID 70183930
2-hydroxy-3-[1-(2-phenylmethoxyphenyl)propyl]benzoic acid
CID 67659398

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2-phenylmethoxybenzoic acid?
The IUPAC name of 3-hydroxy-2-phenylmethoxybenzoic acid (CID 67658329) is 3-hydroxy-2-phenylmethoxybenzoic acid.
What is the SMILES notation for 3-hydroxy-2-phenylmethoxybenzoic acid?
The canonical SMILES for 3-hydroxy-2-phenylmethoxybenzoic acid is O=C(O)c1cccc(O)c1OCc1ccccc1.
What is the InChIKey of 3-hydroxy-2-phenylmethoxybenzoic acid?
The InChIKey is WYASXLBIFSLVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c15-12-8-4-7-11(14(16)17)13(12)18-9-10-5-2-1-3-6-10/h1-8,15H,9H2,(H,16,17).
What are the key properties of 3-hydroxy-2-phenylmethoxybenzoic acid?
3-hydroxy-2-phenylmethoxybenzoic acid has a molecular weight of 244.25 g/mol, XLogP of 2.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-phenylmethoxybenzoic acid is sourced from PubChem (CID 67658329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).