C26H20NaO6 — CID 6334341
CID 6334341 (PubChem CID 6334341) has the molecular formula C26H20NaO6 and a molecular weight of 451.43 g/mol.
| Compound Name | CID 6334341 |
|---|---|
| PubChem CID | 6334341 |
| Molecular Formula | C26H20NaO6 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | — |
| SMILES | O=C(O)c1c(C(=O)O)c(OCc2ccccc2)c2ccccc2c1OCc1ccccc1.[Na] |
| InChI | InChI=1S/C26H20O6.Na/c27-25(28)21-22(26(29)30)24(32-16-18-11-5-2-6-12-18)20-14-8-7-13-19(20)23(21)31-15-17-9-3-1-4-10-17;/h1-14H,15-16H2,(H,27,28)(H,29,30); |
| InChIKey | YPKXACGVVMNIGY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |