C17H17ClO4 — CID 141171152
2-chloro-4-ethyl-6-hydroxy-3-methyl-5-phenylmethoxybenzoic acid (PubChem CID 141171152) has the molecular formula C17H17ClO4 and a molecular weight of 320.77 g/mol. Its IUPAC name is 2-chloro-4-ethyl-6-hydroxy-3-methyl-5-phenylmethoxybenzoic acid.
| Compound Name | 2-chloro-4-ethyl-6-hydroxy-3-methyl-5-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 141171152 |
| Molecular Formula | C17H17ClO4 |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-chloro-4-ethyl-6-hydroxy-3-methyl-5-phenylmethoxybenzoic acid |
| SMILES | CCc1c(C)c(Cl)c(C(=O)O)c(O)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H17ClO4/c1-3-12-10(2)14(18)13(17(20)21)15(19)16(12)22-9-11-7-5-4-6-8-11/h4-8,19H,3,9H2,1-2H3,(H,20,21) |
| InChIKey | SECLZTKUTQGXDW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |