C27H30O3 — CID 54428047
4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butan-2-one (PubChem CID 54428047) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butan-2-one.
| Compound Name | 4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butan-2-one |
|---|---|
| PubChem CID | 54428047 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butan-2-one |
| SMILES | CC(=O)CCc1c(C)c(OCc2ccccc2)c(C)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O3/c1-19(28)15-16-25-22(4)26(29-17-23-11-7-5-8-12-23)20(2)21(3)27(25)30-18-24-13-9-6-10-14-24/h5-14H,15-18H2,1-4H3 |
| InChIKey | WFNDOQNRXPHRMA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |