C21H26O2Se — CID 11574621
4-(2-benzylselanyl-5-methoxy-3,4,6-trimethylphenyl)butan-2-one (PubChem CID 11574621) has the molecular formula C21H26O2Se and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-(2-benzylselanyl-5-methoxy-3,4,6-trimethylphenyl)butan-2-one.
| Compound Name | 4-(2-benzylselanyl-5-methoxy-3,4,6-trimethylphenyl)butan-2-one |
|---|---|
| PubChem CID | 11574621 |
| Molecular Formula | C21H26O2Se |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-(2-benzylselanyl-5-methoxy-3,4,6-trimethylphenyl)butan-2-one |
| SMILES | COc1c(C)c(C)c([Se]Cc2ccccc2)c(CCC(C)=O)c1C |
| InChI | InChI=1S/C21H26O2Se/c1-14(22)11-12-19-17(4)20(23-5)15(2)16(3)21(19)24-13-18-9-7-6-8-10-18/h6-10H,11-13H2,1-5H3 |
| InChIKey | ALWWBTOGYNUTSI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|