C11H10Br4O2 — CID 15890570
4-(2,3,5,6-tetrabromo-4-methoxyphenyl)butan-2-one (PubChem CID 15890570) has the molecular formula C11H10Br4O2 and a molecular weight of 493.82 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrabromo-4-methoxyphenyl)butan-2-one.
| Compound Name | 4-(2,3,5,6-tetrabromo-4-methoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 15890570 |
| Molecular Formula | C11H10Br4O2 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 489.74 |
| IUPAC Name | 4-(2,3,5,6-tetrabromo-4-methoxyphenyl)butan-2-one |
| SMILES | COc1c(Br)c(Br)c(CCC(C)=O)c(Br)c1Br |
| InChI | InChI=1S/C11H10Br4O2/c1-5(16)3-4-6-7(12)9(14)11(17-2)10(15)8(6)13/h3-4H2,1-2H3 |
| InChIKey | KKUGAQQRCFGEIH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|