C12H15BrO2 — CID 117430448
1-(6-bromo-3-methoxy-2,4-dimethylphenyl)propan-2-one (PubChem CID 117430448) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)propan-2-one.
| Compound Name | 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 117430448 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-(6-bromo-3-methoxy-2,4-dimethylphenyl)propan-2-one |
| SMILES | COc1c(C)cc(Br)c(CC(C)=O)c1C |
| InChI | InChI=1S/C12H15BrO2/c1-7-5-11(13)10(6-8(2)14)9(3)12(7)15-4/h5H,6H2,1-4H3 |
| InChIKey | DSBKLYOGAUMNQI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |