C12H15FO3 — CID 117325240
1-(2-fluoro-3,4-dimethoxy-5-methylphenyl)propan-2-one (PubChem CID 117325240) has the molecular formula C12H15FO3 and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-(2-fluoro-3,4-dimethoxy-5-methylphenyl)propan-2-one.
| Compound Name | 1-(2-fluoro-3,4-dimethoxy-5-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 117325240 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(2-fluoro-3,4-dimethoxy-5-methylphenyl)propan-2-one |
| SMILES | COc1c(C)cc(CC(C)=O)c(F)c1OC |
| InChI | InChI=1S/C12H15FO3/c1-7-5-9(6-8(2)14)10(13)12(16-4)11(7)15-3/h5H,6H2,1-4H3 |
| InChIKey | NRZAQSNMDATLPH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |