C11H16FNO3 — CID 117330365
O-[2-(2-fluoro-3,4-dimethoxy-5-methylphenyl)ethyl]hydroxylamine (PubChem CID 117330365) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is O-[2-(2-fluoro-3,4-dimethoxy-5-methylphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(2-fluoro-3,4-dimethoxy-5-methylphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117330365 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | O-[2-(2-fluoro-3,4-dimethoxy-5-methylphenyl)ethyl]hydroxylamine |
| SMILES | COc1c(C)cc(CCON)c(F)c1OC |
| InChI | InChI=1S/C11H16FNO3/c1-7-6-8(4-5-16-13)9(12)11(15-3)10(7)14-2/h6H,4-5,13H2,1-3H3 |
| InChIKey | UABUTUALUQBIAC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|