C11H13FO4 — CID 117328457
3-(2-fluoro-3-hydroxy-4-methoxy-5-methylphenyl)propanoic acid (PubChem CID 117328457) has the molecular formula C11H13FO4 and a molecular weight of 228.22 g/mol. Its IUPAC name is 3-(2-fluoro-3-hydroxy-4-methoxy-5-methylphenyl)propanoic acid.
| Compound Name | 3-(2-fluoro-3-hydroxy-4-methoxy-5-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117328457 |
| Molecular Formula | C11H13FO4 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-(2-fluoro-3-hydroxy-4-methoxy-5-methylphenyl)propanoic acid |
| SMILES | COc1c(C)cc(CCC(=O)O)c(F)c1O |
| InChI | InChI=1S/C11H13FO4/c1-6-5-7(3-4-8(13)14)9(12)10(15)11(6)16-2/h5,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | WFKWNUVYAXCHKN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |