C10H10ClFO4 — CID 84706671
3-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)propanoic acid (PubChem CID 84706671) has the molecular formula C10H10ClFO4 and a molecular weight of 248.64 g/mol. Its IUPAC name is 3-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)propanoic acid.
| Compound Name | 3-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84706671 |
| Molecular Formula | C10H10ClFO4 |
| Molecular Weight | 248.64 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 3-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)propanoic acid |
| SMILES | COc1c(O)c(CCC(=O)O)cc(Cl)c1F |
| InChI | InChI=1S/C10H10ClFO4/c1-16-10-8(12)6(11)4-5(9(10)15)2-3-7(13)14/h4,15H,2-3H2,1H3,(H,13,14) |
| InChIKey | IFGFZNDQVWSQDK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |