C11H13ClO4 — CID 117363741
4-(4-chloro-2-hydroxy-3-methoxyphenyl)butanoic acid (PubChem CID 117363741) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is 4-(4-chloro-2-hydroxy-3-methoxyphenyl)butanoic acid.
| Compound Name | 4-(4-chloro-2-hydroxy-3-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117363741 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-(4-chloro-2-hydroxy-3-methoxyphenyl)butanoic acid |
| SMILES | COc1c(Cl)ccc(CCCC(=O)O)c1O |
| InChI | InChI=1S/C11H13ClO4/c1-16-11-8(12)6-5-7(10(11)15)3-2-4-9(13)14/h5-6,15H,2-4H2,1H3,(H,13,14) |
| InChIKey | PDHQQSVYSACCPF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |