C10H10F2O4 — CID 117335780
3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid (PubChem CID 117335780) has the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. Its IUPAC name is 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid.
| Compound Name | 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117335780 |
| Molecular Formula | C10H10F2O4 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(CCC(=O)O)c(F)c(O)c1F |
| InChI | InChI=1S/C10H10F2O4/c1-16-6-4-5(2-3-7(13)14)8(11)10(15)9(6)12/h4,15H,2-3H2,1H3,(H,13,14) |
| InChIKey | AGPAAWDYNZWWTR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |