3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid

C10H10F2O4 — CID 117335780

IUPAC3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid
SMILESCOc1cc(CCC(=O)O)c(F)c(O)c1F
InChIInChI=1S/C10H10F2O4/c1-16-6-4-5(2-3-7(13)14)8(11)10(15)9(6)12/h4,15H,2-3H2,1H3,(H,13,14)
InChIKeyAGPAAWDYNZWWTR-UHFFFAOYSA-N
MW232.18 g/mol
LogP1.70
Rot. Bonds4

About 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid

3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid (PubChem CID 117335780) has the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. Its IUPAC name is 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid
PubChem CID117335780
Molecular FormulaC10H10F2O4
Molecular Weight232.18 g/mol
Exact Mass232.05
IUPAC Name3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid
SMILESCOc1cc(CCC(=O)O)c(F)c(O)c1F
InChIInChI=1S/C10H10F2O4/c1-16-6-4-5(2-3-7(13)14)8(11)10(15)9(6)12/h4,15H,2-3H2,1H3,(H,13,14)
InChIKeyAGPAAWDYNZWWTR-UHFFFAOYSA-N
XLogP1.70
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.18
LogP ≤ 51.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid?
The IUPAC name of 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid (CID 117335780) is 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid?
The canonical SMILES for 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid is COc1cc(CCC(=O)O)c(F)c(O)c1F.
What is the InChIKey of 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid?
The InChIKey is AGPAAWDYNZWWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O4/c1-16-6-4-5(2-3-7(13)14)8(11)10(15)9(6)12/h4,15H,2-3H2,1H3,(H,13,14).
What are the key properties of 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid?
3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid has a molecular weight of 232.18 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluoro-3-hydroxy-5-methoxyphenyl)propanoic acid is sourced from PubChem (CID 117335780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).