C13H17FO4 — CID 117393988
3-[2-(1-fluoroethyl)-4,5-dimethoxyphenyl]propanoic acid (PubChem CID 117393988) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-[2-(1-fluoroethyl)-4,5-dimethoxyphenyl]propanoic acid.
| Compound Name | 3-[2-(1-fluoroethyl)-4,5-dimethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 117393988 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[2-(1-fluoroethyl)-4,5-dimethoxyphenyl]propanoic acid |
| SMILES | COc1cc(CCC(=O)O)c(C(C)F)cc1OC |
| InChI | InChI=1S/C13H17FO4/c1-8(14)10-7-12(18-3)11(17-2)6-9(10)4-5-13(15)16/h6-8H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | WHFCEWMBUSQCAD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |