C12H15IO5 — CID 122391909
3-(2-iodo-3,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 122391909) has the molecular formula C12H15IO5 and a molecular weight of 366.15 g/mol. Its IUPAC name is 3-(2-iodo-3,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 3-(2-iodo-3,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 122391909 |
| Molecular Formula | C12H15IO5 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 3-(2-iodo-3,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(CCC(=O)O)c(I)c(OC)c1OC |
| InChI | InChI=1S/C12H15IO5/c1-16-8-6-7(4-5-9(14)15)10(13)12(18-3)11(8)17-2/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | GHDJZOUBBRZGCH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|