C13H19N5O4 — CID 168604302
3-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,3-dimethoxyphenyl]propanoic acid (PubChem CID 168604302) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,3-dimethoxyphenyl]propanoic acid.
| Compound Name | 3-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,3-dimethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 168604302 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-[5-[[amino-(diaminomethylideneamino)methylidene]amino]-2,3-dimethoxyphenyl]propanoic acid |
| SMILES | COc1cc(/N=C(\N)N=C(N)N)cc(CCC(=O)O)c1OC |
| InChI | InChI=1S/C13H19N5O4/c1-21-9-6-8(17-13(16)18-12(14)15)5-7(11(9)22-2)3-4-10(19)20/h5-6H,3-4H2,1-2H3,(H,19,20)(H6,14,15,16,17,18) |
| InChIKey | VHFCXNFYMAINAH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|