C11H13ClO5 — CID 117406006
3-(2-chloro-3-hydroxy-5,6-dimethoxyphenyl)propanoic acid (PubChem CID 117406006) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is 3-(2-chloro-3-hydroxy-5,6-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-(2-chloro-3-hydroxy-5,6-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117406006 |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(2-chloro-3-hydroxy-5,6-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(O)c(Cl)c(CCC(=O)O)c1OC |
| InChI | InChI=1S/C11H13ClO5/c1-16-8-5-7(13)10(12)6(11(8)17-2)3-4-9(14)15/h5,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | LHPVUHUBNQXDIC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |