C11H13FO5 — CID 117361952
3-(3-fluoro-2-hydroxy-5,6-dimethoxyphenyl)propanoic acid (PubChem CID 117361952) has the molecular formula C11H13FO5 and a molecular weight of 244.22 g/mol. Its IUPAC name is 3-(3-fluoro-2-hydroxy-5,6-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-(3-fluoro-2-hydroxy-5,6-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117361952 |
| Molecular Formula | C11H13FO5 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(3-fluoro-2-hydroxy-5,6-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(F)c(O)c(CCC(=O)O)c1OC |
| InChI | InChI=1S/C11H13FO5/c1-16-8-5-7(12)10(15)6(11(8)17-2)3-4-9(13)14/h5,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | KYSUNSUTTBIUFM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |