C11H12ClFO4 — CID 117411352
4-(2-chloro-3-fluoro-6-hydroxy-5-methoxyphenyl)butanoic acid (PubChem CID 117411352) has the molecular formula C11H12ClFO4 and a molecular weight of 262.66 g/mol. Its IUPAC name is 4-(2-chloro-3-fluoro-6-hydroxy-5-methoxyphenyl)butanoic acid.
| Compound Name | 4-(2-chloro-3-fluoro-6-hydroxy-5-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117411352 |
| Molecular Formula | C11H12ClFO4 |
| Molecular Weight | 262.66 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-(2-chloro-3-fluoro-6-hydroxy-5-methoxyphenyl)butanoic acid |
| SMILES | COc1cc(F)c(Cl)c(CCCC(=O)O)c1O |
| InChI | InChI=1S/C11H12ClFO4/c1-17-8-5-7(13)10(12)6(11(8)16)3-2-4-9(14)15/h5,16H,2-4H2,1H3,(H,14,15) |
| InChIKey | HOYGQLYGNONKTD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |