C8H8Cl2O3 — CID 154103285
2,4-dichloro-3,5-dimethoxyphenol (PubChem CID 154103285) has the molecular formula C8H8Cl2O3 and a molecular weight of 223.05 g/mol. Its IUPAC name is 2,4-dichloro-3,5-dimethoxyphenol.
| Compound Name | 2,4-dichloro-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 154103285 |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2,4-dichloro-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(Cl)c(OC)c1Cl |
| InChI | InChI=1S/C8H8Cl2O3/c1-12-5-3-4(11)6(9)8(13-2)7(5)10/h3,11H,1-2H3 |
| InChIKey | SUOPNVIGVNMVEH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |