C10H14ClNO3 — CID 84795051
4-chloro-3,5-dimethoxy-2-(methylaminomethyl)phenol (PubChem CID 84795051) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 4-chloro-3,5-dimethoxy-2-(methylaminomethyl)phenol.
| Compound Name | 4-chloro-3,5-dimethoxy-2-(methylaminomethyl)phenol |
|---|---|
| PubChem CID | 84795051 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-chloro-3,5-dimethoxy-2-(methylaminomethyl)phenol |
| SMILES | CNCc1c(O)cc(OC)c(Cl)c1OC |
| InChI | InChI=1S/C10H14ClNO3/c1-12-5-6-7(13)4-8(14-2)9(11)10(6)15-3/h4,12-13H,5H2,1-3H3 |
| InChIKey | PBQVNUYXJHAJAS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|