C9H9ClO4 — CID 12652203
3-chloro-6-hydroxy-2,4-dimethoxybenzaldehyde (PubChem CID 12652203) has the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. Its IUPAC name is 3-chloro-6-hydroxy-2,4-dimethoxybenzaldehyde.
| Compound Name | 3-chloro-6-hydroxy-2,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 12652203 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3-chloro-6-hydroxy-2,4-dimethoxybenzaldehyde |
| SMILES | COc1cc(O)c(C=O)c(OC)c1Cl |
| InChI | InChI=1S/C9H9ClO4/c1-13-7-3-6(12)5(4-11)9(14-2)8(7)10/h3-4,12H,1-2H3 |
| InChIKey | SMPVSJALCSYNPT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|