C9H9ClO3 — CID 15414486
3-chloro-2,6-dimethoxybenzaldehyde (PubChem CID 15414486) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is 3-chloro-2,6-dimethoxybenzaldehyde.
| Compound Name | 3-chloro-2,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 15414486 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 3-chloro-2,6-dimethoxybenzaldehyde |
| SMILES | COc1ccc(Cl)c(OC)c1C=O |
| InChI | InChI=1S/C9H9ClO3/c1-12-8-4-3-7(10)9(13-2)6(8)5-11/h3-5H,1-2H3 |
| InChIKey | FMYBNVNGYYJAGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|