C28H24O6 — CID 10742444
6-[5-(2-formyl-3,4-dimethoxyphenyl)naphthalen-1-yl]-2,3-dimethoxybenzaldehyde (PubChem CID 10742444) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is 6-[5-(2-formyl-3,4-dimethoxyphenyl)naphthalen-1-yl]-2,3-dimethoxybenzaldehyde.
| Compound Name | 6-[5-(2-formyl-3,4-dimethoxyphenyl)naphthalen-1-yl]-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 10742444 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 6-[5-(2-formyl-3,4-dimethoxyphenyl)naphthalen-1-yl]-2,3-dimethoxybenzaldehyde |
| SMILES | COc1ccc(-c2cccc3c(-c4ccc(OC)c(OC)c4C=O)cccc23)c(C=O)c1OC |
| InChI | InChI=1S/C28H24O6/c1-31-25-13-11-21(23(15-29)27(25)33-3)19-9-5-8-18-17(19)7-6-10-20(18)22-12-14-26(32-2)28(34-4)24(22)16-30/h5-16H,1-4H3 |
| InChIKey | YCDHNJAVBULUOW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|