C10H10O4 — CID 11615337
2,4-dimethoxybenzene-1,3-dicarbaldehyde (PubChem CID 11615337) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2,4-dimethoxybenzene-1,3-dicarbaldehyde.
| Compound Name | 2,4-dimethoxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 11615337 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2,4-dimethoxybenzene-1,3-dicarbaldehyde |
| SMILES | COc1ccc(C=O)c(OC)c1C=O |
| InChI | InChI=1S/C10H10O4/c1-13-9-4-3-7(5-11)10(14-2)8(9)6-12/h3-6H,1-2H3 |
| InChIKey | IFEHNGDBFMBCQW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|