C9H7BrO3 — CID 171003528
4-bromo-2-methoxybenzene-1,3-dicarbaldehyde (PubChem CID 171003528) has the molecular formula C9H7BrO3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 4-bromo-2-methoxybenzene-1,3-dicarbaldehyde.
| Compound Name | 4-bromo-2-methoxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 171003528 |
| Molecular Formula | C9H7BrO3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 4-bromo-2-methoxybenzene-1,3-dicarbaldehyde |
| SMILES | COc1c(C=O)ccc(Br)c1C=O |
| InChI | InChI=1S/C9H7BrO3/c1-13-9-6(4-11)2-3-8(10)7(9)5-12/h2-5H,1H3 |
| InChIKey | UWXJHKGPRWNHPK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|