C9H8Br2O3 — CID 42626303
3,5-dibromo-2,4-dimethoxybenzaldehyde (PubChem CID 42626303) has the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. Its IUPAC name is 3,5-dibromo-2,4-dimethoxybenzaldehyde.
| Compound Name | 3,5-dibromo-2,4-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 42626303 |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 3,5-dibromo-2,4-dimethoxybenzaldehyde |
| SMILES | COc1c(Br)cc(C=O)c(OC)c1Br |
| InChI | InChI=1S/C9H8Br2O3/c1-13-8-5(4-12)3-6(10)9(14-2)7(8)11/h3-4H,1-2H3 |
| InChIKey | ZQWNNAAHCFHFOB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|