C11H10BrNO3 — CID 163323842
5-bromo-4,7-dimethoxy-1H-indole-3-carbaldehyde (PubChem CID 163323842) has the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. Its IUPAC name is 5-bromo-4,7-dimethoxy-1H-indole-3-carbaldehyde.
| Compound Name | 5-bromo-4,7-dimethoxy-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 163323842 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 5-bromo-4,7-dimethoxy-1H-indole-3-carbaldehyde |
| SMILES | COc1cc(Br)c(OC)c2c(C=O)c[nH]c12 |
| InChI | InChI=1S/C11H10BrNO3/c1-15-8-3-7(12)11(16-2)9-6(5-14)4-13-10(8)9/h3-5,13H,1-2H3 |
| InChIKey | MGMCEWHTVRMCTG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|