C45H51Br3O15 — CID 139206863
2-bromo-1,4,5,7,8-pentamethoxynaphthalene (PubChem CID 139206863) has the molecular formula C45H51Br3O15 and a molecular weight of 1071.60 g/mol. Its IUPAC name is 2-bromo-1,4,5,7,8-pentamethoxynaphthalene.
| Compound Name | 2-bromo-1,4,5,7,8-pentamethoxynaphthalene |
|---|---|
| PubChem CID | 139206863 |
| Molecular Formula | C45H51Br3O15 |
| Molecular Weight | 1071.60 g/mol |
| Exact Mass | 1068.08 |
| IUPAC Name | 2-bromo-1,4,5,7,8-pentamethoxynaphthalene |
| SMILES | COc1cc(OC)c2c(OC)cc(Br)c(OC)c2c1OC.COc1cc(OC)c2c(OC)cc(Br)c(OC)c2c1OC.COc1cc(OC)c2c(OC)cc(Br)c(OC)c2c1OC |
| InChI | InChI=1S/3C15H17BrO5/c3*1-17-9-6-8(16)14(20-4)13-12(9)10(18-2)7-11(19-3)15(13)21-5/h3*6-7H,1-5H3 |
| InChIKey | LLDUEEQTQYHLDX-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 138.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.60 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |