C13H11BrO6 — CID 134854549
methyl 5-bromo-7,8-dimethoxy-1-oxoisochromene-3-carboxylate (PubChem CID 134854549) has the molecular formula C13H11BrO6 and a molecular weight of 343.13 g/mol. Its IUPAC name is methyl 5-bromo-7,8-dimethoxy-1-oxoisochromene-3-carboxylate.
| Compound Name | methyl 5-bromo-7,8-dimethoxy-1-oxoisochromene-3-carboxylate |
|---|---|
| PubChem CID | 134854549 |
| Molecular Formula | C13H11BrO6 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | methyl 5-bromo-7,8-dimethoxy-1-oxoisochromene-3-carboxylate |
| SMILES | COC(=O)c1cc2c(Br)cc(OC)c(OC)c2c(=O)o1 |
| InChI | InChI=1S/C13H11BrO6/c1-17-8-5-7(14)6-4-9(12(15)19-3)20-13(16)10(6)11(8)18-2/h4-5H,1-3H3 |
| InChIKey | OZQIDIPOKWKJPL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |