methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate

C12H12BrNO4 — CID 7144594

IUPACmethyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate
SMILESCOC(=O)c1cc2c(Br)cc(OC)c(OC)c2[nH]1
InChIInChI=1S/C12H12BrNO4/c1-16-9-5-7(13)6-4-8(12(15)18-3)14-10(6)11(9)17-2/h4-5,14H,1-3H3
InChIKeyDKGRTAFJEJRVEA-UHFFFAOYSA-N
MW314.14 g/mol
LogP2.73
Rot. Bonds3

About methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate

methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate (PubChem CID 7144594) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate
PubChem CID7144594
Molecular FormulaC12H12BrNO4
Molecular Weight314.14 g/mol
Exact Mass312.99
IUPAC Namemethyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate
SMILESCOC(=O)c1cc2c(Br)cc(OC)c(OC)c2[nH]1
InChIInChI=1S/C12H12BrNO4/c1-16-9-5-7(13)6-4-8(12(15)18-3)14-10(6)11(9)17-2/h4-5,14H,1-3H3
InChIKeyDKGRTAFJEJRVEA-UHFFFAOYSA-N
XLogP2.73
TPSA60.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.14
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate?
The IUPAC name of methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate (CID 7144594) is methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate?
The canonical SMILES for methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate is COC(=O)c1cc2c(Br)cc(OC)c(OC)c2[nH]1.
What is the InChIKey of methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate?
The InChIKey is DKGRTAFJEJRVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO4/c1-16-9-5-7(13)6-4-8(12(15)18-3)14-10(6)11(9)17-2/h4-5,14H,1-3H3.
What are the key properties of methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate?
methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate has a molecular weight of 314.14 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-6,7-dimethoxy-1H-indole-2-carboxylate is sourced from PubChem (CID 7144594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).